C20H28N2O3Si — CID 22900736
3-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-1-hydroxy-1-methylurea (PubChem CID 22900736) has the molecular formula C20H28N2O3Si and a molecular weight of 372.54 g/mol. Its IUPAC name is 3-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-1-hydroxy-1-methylurea.
| Compound Name | 3-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-1-hydroxy-1-methylurea |
|---|---|
| PubChem CID | 22900736 |
| Molecular Formula | C20H28N2O3Si |
| Molecular Weight | 372.54 g/mol |
| Exact Mass | 372.19 |
| IUPAC Name | 3-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-1-hydroxy-1-methylurea |
| SMILES | CN(O)C(=O)NCCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C20H28N2O3Si/c1-20(2,3)26(17-11-7-5-8-12-17,18-13-9-6-10-14-18)25-16-15-21-19(23)22(4)24/h5-14,24H,15-16H2,1-4H3,(H,21,23) |
| InChIKey | XSXYXYRZXSPOGK-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.54 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|