C20H27NO2Si — CID 58715072
N-[(2R)-2-[tert-butyl(diphenyl)silyl]oxypropyl]formamide (PubChem CID 58715072) has the molecular formula C20H27NO2Si and a molecular weight of 341.53 g/mol. Its IUPAC name is N-[(2R)-2-[tert-butyl(diphenyl)silyl]oxypropyl]formamide.
| Compound Name | N-[(2R)-2-[tert-butyl(diphenyl)silyl]oxypropyl]formamide |
|---|---|
| PubChem CID | 58715072 |
| Molecular Formula | C20H27NO2Si |
| Molecular Weight | 341.53 g/mol |
| Exact Mass | 341.18 |
| IUPAC Name | N-[(2R)-2-[tert-butyl(diphenyl)silyl]oxypropyl]formamide |
| SMILES | C[C@H](CNC=O)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C20H27NO2Si/c1-17(15-21-16-22)23-24(20(2,3)4,18-11-7-5-8-12-18)19-13-9-6-10-14-19/h5-14,16-17H,15H2,1-4H3,(H,21,22)/t17-/m1/s1 |
| InChIKey | JOKDXRFUQDMRJK-QGZVFWFLSA-N |
| XLogP | 2.70 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.53 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|