C19H25NO3Si — CID 22242877
2-[tert-butyl(diphenyl)silyl]oxyethylcarbamic acid (PubChem CID 22242877) has the molecular formula C19H25NO3Si and a molecular weight of 343.50 g/mol. Its IUPAC name is 2-[tert-butyl(diphenyl)silyl]oxyethylcarbamic acid.
| Compound Name | 2-[tert-butyl(diphenyl)silyl]oxyethylcarbamic acid |
|---|---|
| PubChem CID | 22242877 |
| Molecular Formula | C19H25NO3Si |
| Molecular Weight | 343.50 g/mol |
| Exact Mass | 343.16 |
| IUPAC Name | 2-[tert-butyl(diphenyl)silyl]oxyethylcarbamic acid |
| SMILES | CC(C)(C)[Si](OCCNC(=O)O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H25NO3Si/c1-19(2,3)24(16-10-6-4-7-11-16,17-12-8-5-9-13-17)23-15-14-20-18(21)22/h4-13,20H,14-15H2,1-3H3,(H,21,22) |
| InChIKey | PRTUYBNVVZNWGW-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.50 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|