C17H16ClN2O+ — CID 123936350
3-(3-chlorophenoxy)-4-(2,4-dimethylazet-1-ium-1-yl)aniline (PubChem CID 123936350) has the molecular formula C17H16ClN2O+ and a molecular weight of 299.78 g/mol. Its IUPAC name is 3-(3-chlorophenoxy)-4-(2,4-dimethylazet-1-ium-1-yl)aniline.
| Compound Name | 3-(3-chlorophenoxy)-4-(2,4-dimethylazet-1-ium-1-yl)aniline |
|---|---|
| PubChem CID | 123936350 |
| Molecular Formula | C17H16ClN2O+ |
| Molecular Weight | 299.78 g/mol |
| Exact Mass | 299.09 |
| IUPAC Name | 3-(3-chlorophenoxy)-4-(2,4-dimethylazet-1-ium-1-yl)aniline |
| SMILES | CC1=CC(C)=[N+]1c1ccc(N)cc1Oc1cccc(Cl)c1 |
| InChI | InChI=1S/C17H16ClN2O/c1-11-8-12(2)20(11)16-7-6-14(19)10-17(16)21-15-5-3-4-13(18)9-15/h3-10H,19H2,1-2H3/q+1 |
| InChIKey | LXIKTBLCHINEFH-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 38.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.78 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|