C21H27N5O4S — CID 123937801
N-[5-(3,4a,5,6,7,7a-hexahydro-2H-pyrrolo[3,4-b][1,4]oxazin-4-ylsulfonyl)-2-methylhexa-2,4-dienyl]imidazo[1,2-a]pyridine-6-carboxamide (PubChem CID 123937801) has the molecular formula C21H27N5O4S and a molecular weight of 445.55 g/mol. Its IUPAC name is N-[5-(3,4a,5,6,7,7a-hexahydro-2H-pyrrolo[3,4-b][1,4]oxazin-4-ylsulfonyl)-2-methylhexa-2,4-dienyl]imidazo[1,2-a]pyridine-6-carboxamide.
| Compound Name | N-[5-(3,4a,5,6,7,7a-hexahydro-2H-pyrrolo[3,4-b][1,4]oxazin-4-ylsulfonyl)-2-methylhexa-2,4-dienyl]imidazo[1,2-a]pyridine-6-carboxamide |
|---|---|
| PubChem CID | 123937801 |
| Molecular Formula | C21H27N5O4S |
| Molecular Weight | 445.55 g/mol |
| Exact Mass | 445.18 |
| IUPAC Name | N-[5-(3,4a,5,6,7,7a-hexahydro-2H-pyrrolo[3,4-b][1,4]oxazin-4-ylsulfonyl)-2-methylhexa-2,4-dienyl]imidazo[1,2-a]pyridine-6-carboxamide |
| SMILES | CC(=CC=C(C)S(=O)(=O)N1CCOC2CNCC21)CNC(=O)c1ccc2nccn2c1 |
| InChI | InChI=1S/C21H27N5O4S/c1-15(11-24-21(27)17-5-6-20-23-7-8-25(20)14-17)3-4-16(2)31(28,29)26-9-10-30-19-13-22-12-18(19)26/h3-8,14,18-19,22H,9-13H2,1-2H3,(H,24,27) |
| InChIKey | DDXAVDVPHVJLJU-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 105.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.55 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|