C23H26FN7O3 — CID 123937823
N-[4-amino-2-[5-(3-aminooxyprop-2-enyl)-1-[(2-fluorophenyl)methyl]pyrazol-3-yl]pyrimidin-5-yl]-1-(methoxymethyl)cyclopropane-1-carboxamide (PubChem CID 123937823) has the molecular formula C23H26FN7O3 and a molecular weight of 467.51 g/mol. Its IUPAC name is N-[4-amino-2-[5-(3-aminooxyprop-2-enyl)-1-[(2-fluorophenyl)methyl]pyrazol-3-yl]pyrimidin-5-yl]-1-(methoxymethyl)cyclopropane-1-carboxamide.
| Compound Name | N-[4-amino-2-[5-(3-aminooxyprop-2-enyl)-1-[(2-fluorophenyl)methyl]pyrazol-3-yl]pyrimidin-5-yl]-1-(methoxymethyl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 123937823 |
| Molecular Formula | C23H26FN7O3 |
| Molecular Weight | 467.51 g/mol |
| Exact Mass | 467.21 |
| IUPAC Name | N-[4-amino-2-[5-(3-aminooxyprop-2-enyl)-1-[(2-fluorophenyl)methyl]pyrazol-3-yl]pyrimidin-5-yl]-1-(methoxymethyl)cyclopropane-1-carboxamide |
| SMILES | COCC1(C(=O)Nc2cnc(-c3cc(CC=CON)n(Cc4ccccc4F)n3)nc2N)CC1 |
| InChI | InChI=1S/C23H26FN7O3/c1-33-14-23(8-9-23)22(32)28-19-12-27-21(29-20(19)25)18-11-16(6-4-10-34-26)31(30-18)13-15-5-2-3-7-17(15)24/h2-5,7,10-12H,6,8-9,13-14,26H2,1H3,(H,28,32)(H2,25,27,29) |
| InChIKey | CWDTXGPUBGOEDU-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 143.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.51 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|