C22H19N2O2S+ — CID 123938514
6-[2-(1,3-benzodioxol-5-yl)-1-propylpyridin-1-ium-3-yl]-1,3-benzothiazole (PubChem CID 123938514) has the molecular formula C22H19N2O2S+ and a molecular weight of 375.47 g/mol. Its IUPAC name is 6-[2-(1,3-benzodioxol-5-yl)-1-propylpyridin-1-ium-3-yl]-1,3-benzothiazole.
| Compound Name | 6-[2-(1,3-benzodioxol-5-yl)-1-propylpyridin-1-ium-3-yl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 123938514 |
| Molecular Formula | C22H19N2O2S+ |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.12 |
| IUPAC Name | 6-[2-(1,3-benzodioxol-5-yl)-1-propylpyridin-1-ium-3-yl]-1,3-benzothiazole |
| SMILES | CCC[n+]1cccc(-c2ccc3ncsc3c2)c1-c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C22H19N2O2S/c1-2-9-24-10-3-4-17(15-5-7-18-21(12-15)27-13-23-18)22(24)16-6-8-19-20(11-16)26-14-25-19/h3-8,10-13H,2,9,14H2,1H3/q+1 |
| InChIKey | JTFBKDKAIWRGBN-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 35.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|