C10H9BrFNO2 — CID 123940141
5-(5-bromo-2-fluorophenyl)-1,3-oxazinan-2-one (PubChem CID 123940141) has the molecular formula C10H9BrFNO2 and a molecular weight of 274.09 g/mol. Its IUPAC name is 5-(5-bromo-2-fluorophenyl)-1,3-oxazinan-2-one.
| Compound Name | 5-(5-bromo-2-fluorophenyl)-1,3-oxazinan-2-one |
|---|---|
| PubChem CID | 123940141 |
| Molecular Formula | C10H9BrFNO2 |
| Molecular Weight | 274.09 g/mol |
| Exact Mass | 272.98 |
| IUPAC Name | 5-(5-bromo-2-fluorophenyl)-1,3-oxazinan-2-one |
| SMILES | O=C1NCC(c2cc(Br)ccc2F)CO1 |
| InChI | InChI=1S/C10H9BrFNO2/c11-7-1-2-9(12)8(3-7)6-4-13-10(14)15-5-6/h1-3,6H,4-5H2,(H,13,14) |
| InChIKey | UXGUKADLVZINKD-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.09 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |