C25H20ClF7N4O — CID 123940902
[1-[3-[4-[5-[4-chloro-3-(trifluoromethyl)phenyl]-5-(trifluoromethyl)-2H-1,2-oxazol-3-yl]phenyl]-3-fluoroazetidin-1-yl]-2-methylpropylidene]cyanamide (PubChem CID 123940902) has the molecular formula C25H20ClF7N4O and a molecular weight of 560.90 g/mol. Its IUPAC name is [1-[3-[4-[5-[4-chloro-3-(trifluoromethyl)phenyl]-5-(trifluoromethyl)-2H-1,2-oxazol-3-yl]phenyl]-3-fluoroazetidin-1-yl]-2-methylpropylidene]cyanamide.
| Compound Name | [1-[3-[4-[5-[4-chloro-3-(trifluoromethyl)phenyl]-5-(trifluoromethyl)-2H-1,2-oxazol-3-yl]phenyl]-3-fluoroazetidin-1-yl]-2-methylpropylidene]cyanamide |
|---|---|
| PubChem CID | 123940902 |
| Molecular Formula | C25H20ClF7N4O |
| Molecular Weight | 560.90 g/mol |
| Exact Mass | 560.12 |
| IUPAC Name | [1-[3-[4-[5-[4-chloro-3-(trifluoromethyl)phenyl]-5-(trifluoromethyl)-2H-1,2-oxazol-3-yl]phenyl]-3-fluoroazetidin-1-yl]-2-methylpropylidene]cyanamide |
| SMILES | CC(C)/C(=N\C#N)N1CC(F)(c2ccc(C3=CC(c4ccc(Cl)c(C(F)(F)F)c4)(C(F)(F)F)ON3)cc2)C1 |
| InChI | InChI=1S/C25H20ClF7N4O/c1-14(2)21(35-13-34)37-11-22(27,12-37)16-5-3-15(4-6-16)20-10-23(38-36-20,25(31,32)33)17-7-8-19(26)18(9-17)24(28,29)30/h3-10,14,36H,11-12H2,1-2H3/b35-21+ |
| InChIKey | UHAVZUUGNVDCSS-XICOUIIWSA-N |
| XLogP | 6.71 |
| TPSA | 60.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.90 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|