C23H18F7N5O — CID 123169407
[1-[3-fluoro-3-[5-[5-(trifluoromethyl)-5-(3,4,5-trifluorophenyl)-2H-1,2-oxazol-3-yl]-2-pyridinyl]azetidin-1-yl]-2-methylpropylidene]cyanamide (PubChem CID 123169407) has the molecular formula C23H18F7N5O and a molecular weight of 513.42 g/mol. Its IUPAC name is [1-[3-fluoro-3-[5-[5-(trifluoromethyl)-5-(3,4,5-trifluorophenyl)-2H-1,2-oxazol-3-yl]-2-pyridinyl]azetidin-1-yl]-2-methylpropylidene]cyanamide.
| Compound Name | [1-[3-fluoro-3-[5-[5-(trifluoromethyl)-5-(3,4,5-trifluorophenyl)-2H-1,2-oxazol-3-yl]-2-pyridinyl]azetidin-1-yl]-2-methylpropylidene]cyanamide |
|---|---|
| PubChem CID | 123169407 |
| Molecular Formula | C23H18F7N5O |
| Molecular Weight | 513.42 g/mol |
| Exact Mass | 513.14 |
| IUPAC Name | [1-[3-fluoro-3-[5-[5-(trifluoromethyl)-5-(3,4,5-trifluorophenyl)-2H-1,2-oxazol-3-yl]-2-pyridinyl]azetidin-1-yl]-2-methylpropylidene]cyanamide |
| SMILES | CC(C)/C(=N\C#N)N1CC(F)(c2ccc(C3=CC(c4cc(F)c(F)c(F)c4)(C(F)(F)F)ON3)cn2)C1 |
| InChI | InChI=1S/C23H18F7N5O/c1-12(2)20(33-11-31)35-9-21(27,10-35)18-4-3-13(8-32-18)17-7-22(36-34-17,23(28,29)30)14-5-15(24)19(26)16(25)6-14/h3-8,12,34H,9-10H2,1-2H3/b33-20+ |
| InChIKey | TZFSPZNNBGYSSB-FMFFXOCNSA-N |
| XLogP | 4.85 |
| TPSA | 73.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.42 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|