C12H28N4O3 — CID 123941937
1-[2-(diaminomethyl)pyrrolidin-1-yl]-2-[[hydroxy(methoxy)methyl]amino]-3-methylbutan-1-ol (PubChem CID 123941937) has the molecular formula C12H28N4O3 and a molecular weight of 276.38 g/mol. Its IUPAC name is 1-[2-(diaminomethyl)pyrrolidin-1-yl]-2-[[hydroxy(methoxy)methyl]amino]-3-methylbutan-1-ol.
| Compound Name | 1-[2-(diaminomethyl)pyrrolidin-1-yl]-2-[[hydroxy(methoxy)methyl]amino]-3-methylbutan-1-ol |
|---|---|
| PubChem CID | 123941937 |
| Molecular Formula | C12H28N4O3 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.22 |
| IUPAC Name | 1-[2-(diaminomethyl)pyrrolidin-1-yl]-2-[[hydroxy(methoxy)methyl]amino]-3-methylbutan-1-ol |
| SMILES | COC(O)NC(C(C)C)C(O)N1CCCC1C(N)N |
| InChI | InChI=1S/C12H28N4O3/c1-7(2)9(15-12(18)19-3)11(17)16-6-4-5-8(16)10(13)14/h7-12,15,17-18H,4-6,13-14H2,1-3H3 |
| InChIKey | IHTXIYYMZATGHS-UHFFFAOYSA-N |
| XLogP | -1.45 |
| TPSA | 117.00 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | -1.45 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|