C12H29N3O3 — CID 123219191
1-[2-aminoethyl(propyl)amino]-2-[[hydroxy(methoxy)methyl]amino]-3-methylbutan-1-ol (PubChem CID 123219191) has the molecular formula C12H29N3O3 and a molecular weight of 263.38 g/mol. Its IUPAC name is 1-[2-aminoethyl(propyl)amino]-2-[[hydroxy(methoxy)methyl]amino]-3-methylbutan-1-ol.
| Compound Name | 1-[2-aminoethyl(propyl)amino]-2-[[hydroxy(methoxy)methyl]amino]-3-methylbutan-1-ol |
|---|---|
| PubChem CID | 123219191 |
| Molecular Formula | C12H29N3O3 |
| Molecular Weight | 263.38 g/mol |
| Exact Mass | 263.22 |
| IUPAC Name | 1-[2-aminoethyl(propyl)amino]-2-[[hydroxy(methoxy)methyl]amino]-3-methylbutan-1-ol |
| SMILES | CCCN(CCN)C(O)C(NC(O)OC)C(C)C |
| InChI | InChI=1S/C12H29N3O3/c1-5-7-15(8-6-13)11(16)10(9(2)3)14-12(17)18-4/h9-12,14,16-17H,5-8,13H2,1-4H3 |
| InChIKey | RQRJNVUODCSBNY-UHFFFAOYSA-N |
| XLogP | -0.49 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.38 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|