C38H42N7O2+ — CID 123942484
4-[[4-methyl-4-(2-phenylethoxymethyl)piperazin-4-ium-1-yl]methyl]-N-[4-methyl-3-[(4-pyridin-3-ylpyrimidin-2-yl)amino]phenyl]benzamide (PubChem CID 123942484) has the molecular formula C38H42N7O2+ and a molecular weight of 628.80 g/mol. Its IUPAC name is 4-[[4-methyl-4-(2-phenylethoxymethyl)piperazin-4-ium-1-yl]methyl]-N-[4-methyl-3-[(4-pyridin-3-ylpyrimidin-2-yl)amino]phenyl]benzamide.
| Compound Name | 4-[[4-methyl-4-(2-phenylethoxymethyl)piperazin-4-ium-1-yl]methyl]-N-[4-methyl-3-[(4-pyridin-3-ylpyrimidin-2-yl)amino]phenyl]benzamide |
|---|---|
| PubChem CID | 123942484 |
| Molecular Formula | C38H42N7O2+ |
| Molecular Weight | 628.80 g/mol |
| Exact Mass | 628.34 |
| IUPAC Name | 4-[[4-methyl-4-(2-phenylethoxymethyl)piperazin-4-ium-1-yl]methyl]-N-[4-methyl-3-[(4-pyridin-3-ylpyrimidin-2-yl)amino]phenyl]benzamide |
| SMILES | Cc1ccc(NC(=O)c2ccc(CN3CC[N+](C)(COCCc4ccccc4)CC3)cc2)cc1Nc1nccc(-c2cccnc2)n1 |
| InChI | InChI=1S/C38H41N7O2/c1-29-10-15-34(25-36(29)43-38-40-19-16-35(42-38)33-9-6-18-39-26-33)41-37(46)32-13-11-31(12-14-32)27-44-20-22-45(2,23-21-44)28-47-24-17-30-7-4-3-5-8-30/h3-16,18-19,25-26H,17,20-24,27-28H2,1-2H3,(H-,40,41,42,43,46)/p+1 |
| InChIKey | QGYPKAITEIENMZ-UHFFFAOYSA-O |
| XLogP | 6.32 |
| TPSA | 92.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.80 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|