C25H26N8O — CID 123943157
4-[3-(1,3-diimino-1-phenylbutan-2-yl)-[1,2,4]triazolo[4,3-a]pyridin-7-yl]-N-(oxan-4-yl)pyrimidin-2-amine (PubChem CID 123943157) has the molecular formula C25H26N8O and a molecular weight of 454.54 g/mol. Its IUPAC name is 4-[3-(1,3-diimino-1-phenylbutan-2-yl)-[1,2,4]triazolo[4,3-a]pyridin-7-yl]-N-(oxan-4-yl)pyrimidin-2-amine.
| Compound Name | 4-[3-(1,3-diimino-1-phenylbutan-2-yl)-[1,2,4]triazolo[4,3-a]pyridin-7-yl]-N-(oxan-4-yl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 123943157 |
| Molecular Formula | C25H26N8O |
| Molecular Weight | 454.54 g/mol |
| Exact Mass | 454.22 |
| IUPAC Name | 4-[3-(1,3-diimino-1-phenylbutan-2-yl)-[1,2,4]triazolo[4,3-a]pyridin-7-yl]-N-(oxan-4-yl)pyrimidin-2-amine |
| SMILES | [H]/N=C(\c1ccccc1)C(/C(C)=N/[H])c1nnc2cc(-c3ccnc(NC4CCOCC4)n3)ccn12 |
| InChI | InChI=1S/C25H26N8O/c1-16(26)22(23(27)17-5-3-2-4-6-17)24-32-31-21-15-18(8-12-33(21)24)20-7-11-28-25(30-20)29-19-9-13-34-14-10-19/h2-8,11-12,15,19,22,26-27H,9-10,13-14H2,1H3,(H,28,29,30)/b26-16+,27-23+ |
| InChIKey | WXGWVBLPCISODO-HKGWMZNFSA-N |
| XLogP | 3.97 |
| TPSA | 124.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.54 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|