C32H44N6O3Si — CID 141456479
4-[3-[(1R,2S)-3-[tert-butyl(dimethyl)silyl]oxy-1-(4-methoxyphenyl)-2-methylpropyl]-[1,2,4]triazolo[4,3-a]pyridin-7-yl]-N-(oxan-4-yl)pyrimidin-2-amine (PubChem CID 141456479) has the molecular formula C32H44N6O3Si and a molecular weight of 588.83 g/mol. Its IUPAC name is 4-[3-[(1R,2S)-3-[tert-butyl(dimethyl)silyl]oxy-1-(4-methoxyphenyl)-2-methylpropyl]-[1,2,4]triazolo[4,3-a]pyridin-7-yl]-N-(oxan-4-yl)pyrimidin-2-amine.
| Compound Name | 4-[3-[(1R,2S)-3-[tert-butyl(dimethyl)silyl]oxy-1-(4-methoxyphenyl)-2-methylpropyl]-[1,2,4]triazolo[4,3-a]pyridin-7-yl]-N-(oxan-4-yl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 141456479 |
| Molecular Formula | C32H44N6O3Si |
| Molecular Weight | 588.83 g/mol |
| Exact Mass | 588.32 |
| IUPAC Name | 4-[3-[(1R,2S)-3-[tert-butyl(dimethyl)silyl]oxy-1-(4-methoxyphenyl)-2-methylpropyl]-[1,2,4]triazolo[4,3-a]pyridin-7-yl]-N-(oxan-4-yl)pyrimidin-2-amine |
| SMILES | COc1ccc([C@H](c2nnc3cc(-c4ccnc(NC5CCOCC5)n4)ccn23)[C@H](C)CO[Si](C)(C)C(C)(C)C)cc1 |
| InChI | InChI=1S/C32H44N6O3Si/c1-22(21-41-42(6,7)32(2,3)4)29(23-8-10-26(39-5)11-9-23)30-37-36-28-20-24(13-17-38(28)30)27-12-16-33-31(35-27)34-25-14-18-40-19-15-25/h8-13,16-17,20,22,25,29H,14-15,18-19,21H2,1-7H3,(H,33,34,35)/t22-,29-/m1/s1 |
| InChIKey | PKNLLGKRIRWWSX-KPURRNSFSA-N |
| XLogP | 6.58 |
| TPSA | 95.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.83 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|