C30H23N3OS2Si — CID 123943213
N-(10,10-dimethylbenzo[b][1,4]benzothiasilin-4-yl)-N-phenoxathiin-1-ylpyrimidin-5-amine (PubChem CID 123943213) has the molecular formula C30H23N3OS2Si and a molecular weight of 533.75 g/mol. Its IUPAC name is N-(10,10-dimethylbenzo[b][1,4]benzothiasilin-4-yl)-N-phenoxathiin-1-ylpyrimidin-5-amine.
| Compound Name | N-(10,10-dimethylbenzo[b][1,4]benzothiasilin-4-yl)-N-phenoxathiin-1-ylpyrimidin-5-amine |
|---|---|
| PubChem CID | 123943213 |
| Molecular Formula | C30H23N3OS2Si |
| Molecular Weight | 533.75 g/mol |
| Exact Mass | 533.11 |
| IUPAC Name | N-(10,10-dimethylbenzo[b][1,4]benzothiasilin-4-yl)-N-phenoxathiin-1-ylpyrimidin-5-amine |
| SMILES | C[Si]1(C)c2ccccc2Sc2c(N(c3cncnc3)c3cccc4c3Sc3ccccc3O4)cccc21 |
| InChI | InChI=1S/C30H23N3OS2Si/c1-37(2)27-15-6-5-14-26(27)36-30-22(10-8-16-28(30)37)33(20-17-31-19-32-18-20)21-9-7-12-24-29(21)35-25-13-4-3-11-23(25)34-24/h3-19H,1-2H3 |
| InChIKey | MZPVDXRLAIDDKS-UHFFFAOYSA-N |
| XLogP | 7.49 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.75 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|