C58H45NOS3Si2 — CID 123782068
N,N-bis[4-(10,10-dimethylbenzo[b][1,4]benzothiasilin-4-yl)phenyl]-4-phenoxathiin-1-ylaniline (PubChem CID 123782068) has the molecular formula C58H45NOS3Si2 and a molecular weight of 924.38 g/mol. Its IUPAC name is N,N-bis[4-(10,10-dimethylbenzo[b][1,4]benzothiasilin-4-yl)phenyl]-4-phenoxathiin-1-ylaniline.
| Compound Name | N,N-bis[4-(10,10-dimethylbenzo[b][1,4]benzothiasilin-4-yl)phenyl]-4-phenoxathiin-1-ylaniline |
|---|---|
| PubChem CID | 123782068 |
| Molecular Formula | C58H45NOS3Si2 |
| Molecular Weight | 924.38 g/mol |
| Exact Mass | 923.22 |
| IUPAC Name | N,N-bis[4-(10,10-dimethylbenzo[b][1,4]benzothiasilin-4-yl)phenyl]-4-phenoxathiin-1-ylaniline |
| SMILES | C[Si]1(C)c2ccccc2Sc2c(-c3ccc(N(c4ccc(-c5cccc6c5Sc5ccccc5O6)cc4)c4ccc(-c5cccc6c5Sc5ccccc5[Si]6(C)C)cc4)cc3)cccc21 |
| InChI | InChI=1S/C58H45NOS3Si2/c1-64(2)52-22-9-7-20-50(52)62-57-45(15-12-24-54(57)64)39-28-34-42(35-29-39)59(41-32-26-38(27-33-41)44-14-11-18-48-56(44)61-49-19-6-5-17-47(49)60-48)43-36-30-40(31-37-43)46-16-13-25-55-58(46)63-51-21-8-10-23-53(51)65(55,3)4/h5-37H,1-4H3 |
| InChIKey | KJJIVIONJQWTIQ-UHFFFAOYSA-N |
| XLogP | 14.99 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 924.38 |
| LogP ≤ 5 | 14.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|