C19H24N6O2 — CID 123944018
2-ethyl-8-(5-hydroxypentylamino)-6-(pyrazin-2-ylamino)-2,7-naphthyridin-1-one (PubChem CID 123944018) has the molecular formula C19H24N6O2 and a molecular weight of 368.44 g/mol. Its IUPAC name is 2-ethyl-8-(5-hydroxypentylamino)-6-(pyrazin-2-ylamino)-2,7-naphthyridin-1-one.
| Compound Name | 2-ethyl-8-(5-hydroxypentylamino)-6-(pyrazin-2-ylamino)-2,7-naphthyridin-1-one |
|---|---|
| PubChem CID | 123944018 |
| Molecular Formula | C19H24N6O2 |
| Molecular Weight | 368.44 g/mol |
| Exact Mass | 368.20 |
| IUPAC Name | 2-ethyl-8-(5-hydroxypentylamino)-6-(pyrazin-2-ylamino)-2,7-naphthyridin-1-one |
| SMILES | CCn1ccc2cc(Nc3cnccn3)nc(NCCCCCO)c2c1=O |
| InChI | InChI=1S/C19H24N6O2/c1-2-25-10-6-14-12-15(23-16-13-20-8-9-21-16)24-18(17(14)19(25)27)22-7-4-3-5-11-26/h6,8-10,12-13,26H,2-5,7,11H2,1H3,(H2,21,22,23,24) |
| InChIKey | NFEIFZGFZGDSKH-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 104.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.44 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|