C23H23N7O2 — CID 123782016
4-[3-[[7-methyl-8-oxo-3-(pyrazin-2-ylamino)-2,7-naphthyridin-1-yl]amino]propyl]benzamide (PubChem CID 123782016) has the molecular formula C23H23N7O2 and a molecular weight of 429.48 g/mol. Its IUPAC name is 4-[3-[[7-methyl-8-oxo-3-(pyrazin-2-ylamino)-2,7-naphthyridin-1-yl]amino]propyl]benzamide.
| Compound Name | 4-[3-[[7-methyl-8-oxo-3-(pyrazin-2-ylamino)-2,7-naphthyridin-1-yl]amino]propyl]benzamide |
|---|---|
| PubChem CID | 123782016 |
| Molecular Formula | C23H23N7O2 |
| Molecular Weight | 429.48 g/mol |
| Exact Mass | 429.19 |
| IUPAC Name | 4-[3-[[7-methyl-8-oxo-3-(pyrazin-2-ylamino)-2,7-naphthyridin-1-yl]amino]propyl]benzamide |
| SMILES | Cn1ccc2cc(Nc3cnccn3)nc(NCCCc3ccc(C(N)=O)cc3)c2c1=O |
| InChI | InChI=1S/C23H23N7O2/c1-30-12-8-17-13-18(28-19-14-25-10-11-26-19)29-22(20(17)23(30)32)27-9-2-3-15-4-6-16(7-5-15)21(24)31/h4-8,10-14H,2-3,9H2,1H3,(H2,24,31)(H2,26,27,28,29) |
| InChIKey | HXEILPFEIOPGIA-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 127.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.48 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|