C14H17F3N2OS2 — CID 123945968
(NE)-N-[1-(5-methylthiophen-2-yl)ethylidene]hydroxylamine;2,2,2-trifluoro-1-(5-methylthiophen-2-yl)ethanamine (PubChem CID 123945968) has the molecular formula C14H17F3N2OS2 and a molecular weight of 350.43 g/mol. Its IUPAC name is (NE)-N-[1-(5-methylthiophen-2-yl)ethylidene]hydroxylamine;2,2,2-trifluoro-1-(5-methylthiophen-2-yl)ethanamine.
| Compound Name | (NE)-N-[1-(5-methylthiophen-2-yl)ethylidene]hydroxylamine;2,2,2-trifluoro-1-(5-methylthiophen-2-yl)ethanamine |
|---|---|
| PubChem CID | 123945968 |
| Molecular Formula | C14H17F3N2OS2 |
| Molecular Weight | 350.43 g/mol |
| Exact Mass | 350.07 |
| IUPAC Name | (NE)-N-[1-(5-methylthiophen-2-yl)ethylidene]hydroxylamine;2,2,2-trifluoro-1-(5-methylthiophen-2-yl)ethanamine |
| SMILES | C/C(=N\O)c1ccc(C)s1.Cc1ccc(C(N)C(F)(F)F)s1 |
| InChI | InChI=1S/C7H8F3NS.C7H9NOS/c1-4-2-3-5(12-4)6(11)7(8,9)10;1-5-3-4-7(10-5)6(2)8-9/h2-3,6H,11H2,1H3;3-4,9H,1-2H3/b;8-6+ |
| InChIKey | OMLKCCBMSNXZDL-ZQGZPJDTSA-N |
| XLogP | 4.87 |
| TPSA | 58.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.43 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|