About 5-methyl-2H-benzotriazole;(NZ)-N-[1-(5-methylthiophen-2-yl)ethylidene]hydroxylamine
5-methyl-2H-benzotriazole;(NZ)-N-[1-(5-methylthiophen-2-yl)ethylidene]hydroxylamine (PubChem CID 143652167) has the molecular formula C14H16N4OS
and a molecular weight of 288.38 g/mol. Its IUPAC name is 5-methyl-2H-benzotriazole;(NZ)-N-[1-(5-methylthiophen-2-yl)ethylidene]hydroxylamine.
Molecular Properties
| Compound Name | 5-methyl-2H-benzotriazole;(NZ)-N-[1-(5-methylthiophen-2-yl)ethylidene]hydroxylamine |
| PubChem CID | 143652167 |
| Molecular Formula | C14H16N4OS |
| Molecular Weight | 288.38 g/mol |
| Exact Mass | 288.10 |
| IUPAC Name | 5-methyl-2H-benzotriazole;(NZ)-N-[1-(5-methylthiophen-2-yl)ethylidene]hydroxylamine |
| SMILES | C/C(=N/O)c1ccc(C)s1.Cc1ccc2n[nH]nc2c1 |
| InChI | InChI=1S/C7H7N3.C7H9NOS/c1-5-2-3-6-7(4-5)9-10-8-6;1-5-3-4-7(10-5)6(2)8-9/h2-4H,1H3,(H,8,9,10);3-4,9H,1-2H3/b;8-6- |
| InChIKey | SWUNSNDKDCVAND-SEUOEIGTSA-N |
| XLogP | 3.52 |
| TPSA | 74.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.38 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-methyl-2H-benzotriazole;(NZ)-N-[1-(5-methylthiophen-2-yl)ethylidene]hydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-2H-benzotriazole;(NZ)-N-[1-(5-methylthiophen-2-yl)ethylidene]hydroxylamine?
The IUPAC name of 5-methyl-2H-benzotriazole;(NZ)-N-[1-(5-methylthiophen-2-yl)ethylidene]hydroxylamine (CID 143652167) is 5-methyl-2H-benzotriazole;(NZ)-N-[1-(5-methylthiophen-2-yl)ethylidene]hydroxylamine.
What is the SMILES notation for 5-methyl-2H-benzotriazole;(NZ)-N-[1-(5-methylthiophen-2-yl)ethylidene]hydroxylamine?
The canonical SMILES for 5-methyl-2H-benzotriazole;(NZ)-N-[1-(5-methylthiophen-2-yl)ethylidene]hydroxylamine is C/C(=N/O)c1ccc(C)s1.Cc1ccc2n[nH]nc2c1.
What is the InChIKey of 5-methyl-2H-benzotriazole;(NZ)-N-[1-(5-methylthiophen-2-yl)ethylidene]hydroxylamine?
The InChIKey is SWUNSNDKDCVAND-SEUOEIGTSA-N. The full InChI is InChI=1S/C7H7N3.C7H9NOS/c1-5-2-3-6-7(4-5)9-10-8-6;1-5-3-4-7(10-5)6(2)8-9/h2-4H,1H3,(H,8,9,10);3-4,9H,1-2H3/b;8-6-.
What are the key properties of 5-methyl-2H-benzotriazole;(NZ)-N-[1-(5-methylthiophen-2-yl)ethylidene]hydroxylamine?
5-methyl-2H-benzotriazole;(NZ)-N-[1-(5-methylthiophen-2-yl)ethylidene]hydroxylamine has a molecular weight of 288.38 g/mol, XLogP of 3.52, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-2H-benzotriazole;(NZ)-N-[1-(5-methylthiophen-2-yl)ethylidene]hydroxylamine is sourced from PubChem (CID 143652167), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).