C16H16N6 — CID 158057233
5-methyl-2H-benzotriazole;4-(2-methylphenyl)-2H-triazole (PubChem CID 158057233) has the molecular formula C16H16N6 and a molecular weight of 292.35 g/mol. Its IUPAC name is 5-methyl-2H-benzotriazole;4-(2-methylphenyl)-2H-triazole.
| Compound Name | 5-methyl-2H-benzotriazole;4-(2-methylphenyl)-2H-triazole |
|---|---|
| PubChem CID | 158057233 |
| Molecular Formula | C16H16N6 |
| Molecular Weight | 292.35 g/mol |
| Exact Mass | 292.14 |
| IUPAC Name | 5-methyl-2H-benzotriazole;4-(2-methylphenyl)-2H-triazole |
| SMILES | Cc1ccc2n[nH]nc2c1.Cc1ccccc1-c1cn[nH]n1 |
| InChI | InChI=1S/C9H9N3.C7H7N3/c1-7-4-2-3-5-8(7)9-6-10-12-11-9;1-5-2-3-6-7(4-5)9-10-8-6/h2-6H,1H3,(H,10,11,12);2-4H,1H3,(H,8,9,10) |
| InChIKey | FKEZPMWOUNIATB-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.35 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |