About formaldehyde;4-(2-methylphenyl)-2H-triazole;N-octyloctan-1-amine
formaldehyde;4-(2-methylphenyl)-2H-triazole;N-octyloctan-1-amine (PubChem CID 175191379) has the molecular formula C26H46N4O
and a molecular weight of 430.68 g/mol. Its IUPAC name is formaldehyde;4-(2-methylphenyl)-2H-triazole;N-octyloctan-1-amine.
Molecular Properties
| Compound Name | formaldehyde;4-(2-methylphenyl)-2H-triazole;N-octyloctan-1-amine |
| PubChem CID | 175191379 |
| Molecular Formula | C26H46N4O |
| Molecular Weight | 430.68 g/mol |
| Exact Mass | 430.37 |
| IUPAC Name | formaldehyde;4-(2-methylphenyl)-2H-triazole;N-octyloctan-1-amine |
| SMILES | C=O.CCCCCCCCNCCCCCCCC.Cc1ccccc1-c1cn[nH]n1 |
| InChI | InChI=1S/C16H35N.C9H9N3.CH2O/c1-3-5-7-9-11-13-15-17-16-14-12-10-8-6-4-2;1-7-4-2-3-5-8(7)9-6-10-12-11-9;1-2/h17H,3-16H2,1-2H3;2-6H,1H3,(H,10,11,12);1H2 |
| InChIKey | XUGLRYBWHIRANP-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 430.68 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze formaldehyde;4-(2-methylphenyl)-2H-triazole;N-octyloctan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of formaldehyde;4-(2-methylphenyl)-2H-triazole;N-octyloctan-1-amine?
The IUPAC name of formaldehyde;4-(2-methylphenyl)-2H-triazole;N-octyloctan-1-amine (CID 175191379) is formaldehyde;4-(2-methylphenyl)-2H-triazole;N-octyloctan-1-amine.
What is the SMILES notation for formaldehyde;4-(2-methylphenyl)-2H-triazole;N-octyloctan-1-amine?
The canonical SMILES for formaldehyde;4-(2-methylphenyl)-2H-triazole;N-octyloctan-1-amine is C=O.CCCCCCCCNCCCCCCCC.Cc1ccccc1-c1cn[nH]n1.
What is the InChIKey of formaldehyde;4-(2-methylphenyl)-2H-triazole;N-octyloctan-1-amine?
The InChIKey is XUGLRYBWHIRANP-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H35N.C9H9N3.CH2O/c1-3-5-7-9-11-13-15-17-16-14-12-10-8-6-4-2;1-7-4-2-3-5-8(7)9-6-10-12-11-9;1-2/h17H,3-16H2,1-2H3;2-6H,1H3,(H,10,11,12);1H2.
What are the key properties of formaldehyde;4-(2-methylphenyl)-2H-triazole;N-octyloctan-1-amine?
formaldehyde;4-(2-methylphenyl)-2H-triazole;N-octyloctan-1-amine has a molecular weight of 430.68 g/mol, XLogP of 6.89, 15 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for formaldehyde;4-(2-methylphenyl)-2H-triazole;N-octyloctan-1-amine is sourced from PubChem (CID 175191379), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).