5-methyl-2H-benzotriazole;molecular hydrogen

C7H9N3 — CID 142249958

IUPAC5-methyl-2H-benzotriazole;molecular hydrogen
SMILESCc1ccc2n[nH]nc2c1.[H][H]
InChIInChI=1S/C7H7N3.H2/c1-5-2-3-6-7(4-5)9-10-8-6;/h2-4H,1H3,(H,8,9,10);1H
InChIKeyKCDKWOLYRAICCI-UHFFFAOYSA-N
MW135.17 g/mol
LogP1.51
Rot. Bonds

About 5-methyl-2H-benzotriazole;molecular hydrogen

5-methyl-2H-benzotriazole;molecular hydrogen (PubChem CID 142249958) has the molecular formula C7H9N3 and a molecular weight of 135.17 g/mol. Its IUPAC name is 5-methyl-2H-benzotriazole;molecular hydrogen.

Molecular Properties

Compound Name5-methyl-2H-benzotriazole;molecular hydrogen
PubChem CID142249958
Molecular FormulaC7H9N3
Molecular Weight135.17 g/mol
Exact Mass135.08
IUPAC Name5-methyl-2H-benzotriazole;molecular hydrogen
SMILESCc1ccc2n[nH]nc2c1.[H][H]
InChIInChI=1S/C7H7N3.H2/c1-5-2-3-6-7(4-5)9-10-8-6;/h2-4H,1H3,(H,8,9,10);1H
InChIKeyKCDKWOLYRAICCI-UHFFFAOYSA-N
XLogP1.51
TPSA41.57 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds
Heavy Atoms10
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500135.17
LogP ≤ 51.51
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 5-methyl-2H-benzotriazole;molecular hydrogen with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-methyl-2H-benzotriazole;molecular hydrogen?
The IUPAC name of 5-methyl-2H-benzotriazole;molecular hydrogen (CID 142249958) is 5-methyl-2H-benzotriazole;molecular hydrogen.
What is the SMILES notation for 5-methyl-2H-benzotriazole;molecular hydrogen?
The canonical SMILES for 5-methyl-2H-benzotriazole;molecular hydrogen is Cc1ccc2n[nH]nc2c1.[H][H].
What is the InChIKey of 5-methyl-2H-benzotriazole;molecular hydrogen?
The InChIKey is KCDKWOLYRAICCI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7N3.H2/c1-5-2-3-6-7(4-5)9-10-8-6;/h2-4H,1H3,(H,8,9,10);1H.
What are the key properties of 5-methyl-2H-benzotriazole;molecular hydrogen?
5-methyl-2H-benzotriazole;molecular hydrogen has a molecular weight of 135.17 g/mol, XLogP of 1.51, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-2H-benzotriazole;molecular hydrogen is sourced from PubChem (CID 142249958), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).