C8H10N4 — CID 66637123
(1R)-1-(2H-benzotriazol-5-yl)ethanamine (PubChem CID 66637123) has the molecular formula C8H10N4 and a molecular weight of 162.20 g/mol. Its IUPAC name is (1R)-1-(2H-benzotriazol-5-yl)ethanamine.
| Compound Name | (1R)-1-(2H-benzotriazol-5-yl)ethanamine |
|---|---|
| PubChem CID | 66637123 |
| Molecular Formula | C8H10N4 |
| Molecular Weight | 162.20 g/mol |
| Exact Mass | 162.09 |
| IUPAC Name | (1R)-1-(2H-benzotriazol-5-yl)ethanamine |
| SMILES | C[C@@H](N)c1ccc2n[nH]nc2c1 |
| InChI | InChI=1S/C8H10N4/c1-5(9)6-2-3-7-8(4-6)11-12-10-7/h2-5H,9H2,1H3,(H,10,11,12)/t5-/m1/s1 |
| InChIKey | HXGUWTOXXYHXNR-RXMQYKEDSA-N |
| XLogP | 0.98 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.20 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |