C26H21Cl2F9N6O4 — CID 123947394
1,1,1,3,3,3-hexafluoropropan-2-yl 4-[4-(2-chloro-4-isocyanoanilino)pyrrolo[2,3-d]pyrimidin-7-yl]piperidine-1-carboxylate;1,1,1-trifluoropropan-2-yl carbonochloridate (PubChem CID 123947394) has the molecular formula C26H21Cl2F9N6O4 and a molecular weight of 723.38 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoropropan-2-yl 4-[4-(2-chloro-4-isocyanoanilino)pyrrolo[2,3-d]pyrimidin-7-yl]piperidine-1-carboxylate;1,1,1-trifluoropropan-2-yl carbonochloridate.
| Compound Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 4-[4-(2-chloro-4-isocyanoanilino)pyrrolo[2,3-d]pyrimidin-7-yl]piperidine-1-carboxylate;1,1,1-trifluoropropan-2-yl carbonochloridate |
|---|---|
| PubChem CID | 123947394 |
| Molecular Formula | C26H21Cl2F9N6O4 |
| Molecular Weight | 723.38 g/mol |
| Exact Mass | 722.09 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 4-[4-(2-chloro-4-isocyanoanilino)pyrrolo[2,3-d]pyrimidin-7-yl]piperidine-1-carboxylate;1,1,1-trifluoropropan-2-yl carbonochloridate |
| SMILES | CC(OC(=O)Cl)C(F)(F)F.[C-]#[N+]c1ccc(Nc2ncnc3c2ccn3C2CCN(C(=O)OC(C(F)(F)F)C(F)(F)F)CC2)c(Cl)c1 |
| InChI | InChI=1S/C22H17ClF6N6O2.C4H4ClF3O2/c1-30-12-2-3-16(15(23)10-12)33-17-14-6-9-35(18(14)32-11-31-17)13-4-7-34(8-5-13)20(36)37-19(21(24,25)26)22(27,28)29;1-2(4(6,7)8)10-3(5)9/h2-3,6,9-11,13,19H,4-5,7-8H2,(H,31,32,33);2H,1H3 |
| InChIKey | QBZMJAWXKNGBTA-UHFFFAOYSA-N |
| XLogP | 8.96 |
| TPSA | 102.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 723.38 |
| LogP ≤ 5 | 8.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|