C21H22ClN7O2 — CID 44622383
propan-2-yl 4-[4-[(6-chloro-2-cyano-3-pyridinyl)amino]pyrrolo[2,3-d]pyrimidin-7-yl]piperidine-1-carboxylate (PubChem CID 44622383) has the molecular formula C21H22ClN7O2 and a molecular weight of 439.91 g/mol. Its IUPAC name is propan-2-yl 4-[4-[(6-chloro-2-cyano-3-pyridinyl)amino]pyrrolo[2,3-d]pyrimidin-7-yl]piperidine-1-carboxylate.
| Compound Name | propan-2-yl 4-[4-[(6-chloro-2-cyano-3-pyridinyl)amino]pyrrolo[2,3-d]pyrimidin-7-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 44622383 |
| Molecular Formula | C21H22ClN7O2 |
| Molecular Weight | 439.91 g/mol |
| Exact Mass | 439.15 |
| IUPAC Name | propan-2-yl 4-[4-[(6-chloro-2-cyano-3-pyridinyl)amino]pyrrolo[2,3-d]pyrimidin-7-yl]piperidine-1-carboxylate |
| SMILES | CC(C)OC(=O)N1CCC(n2ccc3c(Nc4ccc(Cl)nc4C#N)ncnc32)CC1 |
| InChI | InChI=1S/C21H22ClN7O2/c1-13(2)31-21(30)28-8-5-14(6-9-28)29-10-7-15-19(24-12-25-20(15)29)27-16-3-4-18(22)26-17(16)11-23/h3-4,7,10,12-14H,5-6,8-9H2,1-2H3,(H,24,25,27) |
| InChIKey | JPOZWICXPSFMOT-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 108.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.91 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|