C11H26O3S4Si — CID 123947780
3-(1,4-diethoxybutoxytetrasulfanyl)propylsilane (PubChem CID 123947780) has the molecular formula C11H26O3S4Si and a molecular weight of 362.68 g/mol. Its IUPAC name is 3-(1,4-diethoxybutoxytetrasulfanyl)propylsilane.
| Compound Name | 3-(1,4-diethoxybutoxytetrasulfanyl)propylsilane |
|---|---|
| PubChem CID | 123947780 |
| Molecular Formula | C11H26O3S4Si |
| Molecular Weight | 362.68 g/mol |
| Exact Mass | 362.05 |
| IUPAC Name | 3-(1,4-diethoxybutoxytetrasulfanyl)propylsilane |
| SMILES | CCOCCCC(OCC)OSSSSCCC[SiH3] |
| InChI | InChI=1S/C11H26O3S4Si/c1-3-12-8-5-7-11(13-4-2)14-16-18-17-15-9-6-10-19/h11H,3-10H2,1-2,19H3 |
| InChIKey | LWBMFHJCDTYOMB-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.68 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|