C25H25ClN8O2 — CID 123948915
6-amino-7-(4-chlorophenyl)-9-[1-[4-[methyl(pyridin-2-yl)amino]but-2-enoyl]pyrrolidin-3-yl]purin-8-one (PubChem CID 123948915) has the molecular formula C25H25ClN8O2 and a molecular weight of 504.98 g/mol. Its IUPAC name is 6-amino-7-(4-chlorophenyl)-9-[1-[4-[methyl(pyridin-2-yl)amino]but-2-enoyl]pyrrolidin-3-yl]purin-8-one.
| Compound Name | 6-amino-7-(4-chlorophenyl)-9-[1-[4-[methyl(pyridin-2-yl)amino]but-2-enoyl]pyrrolidin-3-yl]purin-8-one |
|---|---|
| PubChem CID | 123948915 |
| Molecular Formula | C25H25ClN8O2 |
| Molecular Weight | 504.98 g/mol |
| Exact Mass | 504.18 |
| IUPAC Name | 6-amino-7-(4-chlorophenyl)-9-[1-[4-[methyl(pyridin-2-yl)amino]but-2-enoyl]pyrrolidin-3-yl]purin-8-one |
| SMILES | CN(CC=CC(=O)N1CCC(n2c(=O)n(-c3ccc(Cl)cc3)c3c(N)ncnc32)C1)c1ccccn1 |
| InChI | InChI=1S/C25H25ClN8O2/c1-31(20-5-2-3-12-28-20)13-4-6-21(35)32-14-11-19(15-32)34-24-22(23(27)29-16-30-24)33(25(34)36)18-9-7-17(26)8-10-18/h2-10,12,16,19H,11,13-15H2,1H3,(H2,27,29,30) |
| InChIKey | XWLZHDOPOXATFF-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 115.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.98 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|