C10H20NO4+ — CID 123949193
2,4-dihydroxy-N-(3-hydroxypropyl)-2,3-dimethyl-3-methylbutanamide (PubChem CID 123949193) has the molecular formula C10H20NO4+ and a molecular weight of 218.27 g/mol. Its IUPAC name is 2,4-dihydroxy-N-(3-hydroxypropyl)-2,3-dimethyl-3-methylbutanamide.
| Compound Name | 2,4-dihydroxy-N-(3-hydroxypropyl)-2,3-dimethyl-3-methylbutanamide |
|---|---|
| PubChem CID | 123949193 |
| Molecular Formula | C10H20NO4+ |
| Molecular Weight | 218.27 g/mol |
| Exact Mass | 218.14 |
| IUPAC Name | 2,4-dihydroxy-N-(3-hydroxypropyl)-2,3-dimethyl-3-methylbutanamide |
| SMILES | [CH2+]C(C)(CO)C(C)(O)C(=O)NCCCO |
| InChI | InChI=1S/C10H19NO4/c1-9(2,7-13)10(3,15)8(14)11-5-4-6-12/h12-13,15H,1,4-7H2,2-3H3/p+1 |
| InChIKey | PWXUGHWNWIVRRQ-UHFFFAOYSA-O |
| XLogP | -0.93 |
| TPSA | 89.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.27 |
| LogP ≤ 5 | -0.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|