C30H24N8O5S2 — CID 123950667
carbon dioxide;(3S,4R)-1-[6-methyl-5-oxo-8-(1,3-thiazol-2-yl)-1,8-naphthyridin-2-yl]-4-[methyl-[5-oxo-8-(1,3-thiazol-2-yl)-1,8-naphthyridin-2-yl]amino]pyrrolidine-3-carbaldehyde (PubChem CID 123950667) has the molecular formula C30H24N8O5S2 and a molecular weight of 640.71 g/mol. Its IUPAC name is carbon dioxide;(3S,4R)-1-[6-methyl-5-oxo-8-(1,3-thiazol-2-yl)-1,8-naphthyridin-2-yl]-4-[methyl-[5-oxo-8-(1,3-thiazol-2-yl)-1,8-naphthyridin-2-yl]amino]pyrrolidine-3-carbaldehyde.
| Compound Name | carbon dioxide;(3S,4R)-1-[6-methyl-5-oxo-8-(1,3-thiazol-2-yl)-1,8-naphthyridin-2-yl]-4-[methyl-[5-oxo-8-(1,3-thiazol-2-yl)-1,8-naphthyridin-2-yl]amino]pyrrolidine-3-carbaldehyde |
|---|---|
| PubChem CID | 123950667 |
| Molecular Formula | C30H24N8O5S2 |
| Molecular Weight | 640.71 g/mol |
| Exact Mass | 640.13 |
| IUPAC Name | carbon dioxide;(3S,4R)-1-[6-methyl-5-oxo-8-(1,3-thiazol-2-yl)-1,8-naphthyridin-2-yl]-4-[methyl-[5-oxo-8-(1,3-thiazol-2-yl)-1,8-naphthyridin-2-yl]amino]pyrrolidine-3-carbaldehyde |
| SMILES | Cc1cn(-c2nccs2)c2nc(N3C[C@H](C=O)[C@@H](N(C)c4ccc5c(=O)ccn(-c6nccs6)c5n4)C3)ccc2c1=O.O=C=O |
| InChI | InChI=1S/C29H24N8O3S2.CO2/c1-17-13-37(29-31-9-12-42-29)27-20(25(17)40)4-6-24(33-27)35-14-18(16-38)21(15-35)34(2)23-5-3-19-22(39)7-10-36(26(19)32-23)28-30-8-11-41-28;2-1-3/h3-13,16,18,21H,14-15H2,1-2H3;/t18-,21+;/m1./s1 |
| InChIKey | DAXAJTKNOLWPAX-WKOQGQMTSA-N |
| XLogP | 2.86 |
| TPSA | 153.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.71 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|