C13H19NS — CID 123952024
2-(2,3,3a,7a-tetrahydro-1H-inden-2-yl)thiomorpholine (PubChem CID 123952024) has the molecular formula C13H19NS and a molecular weight of 221.37 g/mol. Its IUPAC name is 2-(2,3,3a,7a-tetrahydro-1H-inden-2-yl)thiomorpholine.
| Compound Name | 2-(2,3,3a,7a-tetrahydro-1H-inden-2-yl)thiomorpholine |
|---|---|
| PubChem CID | 123952024 |
| Molecular Formula | C13H19NS |
| Molecular Weight | 221.37 g/mol |
| Exact Mass | 221.12 |
| IUPAC Name | 2-(2,3,3a,7a-tetrahydro-1H-inden-2-yl)thiomorpholine |
| SMILES | C1=CC2CC(C3CNCCS3)CC2C=C1 |
| InChI | InChI=1S/C13H19NS/c1-2-4-11-8-12(7-10(11)3-1)13-9-14-5-6-15-13/h1-4,10-14H,5-9H2 |
| InChIKey | KBCWOFWAWPWVOU-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.37 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |