C13H21NS — CID 91246908
3-(1-cyclohexa-2,4-dien-1-ylsulfanylethyl)piperidine (PubChem CID 91246908) has the molecular formula C13H21NS and a molecular weight of 223.39 g/mol. Its IUPAC name is 3-(1-cyclohexa-2,4-dien-1-ylsulfanylethyl)piperidine.
| Compound Name | 3-(1-cyclohexa-2,4-dien-1-ylsulfanylethyl)piperidine |
|---|---|
| PubChem CID | 91246908 |
| Molecular Formula | C13H21NS |
| Molecular Weight | 223.39 g/mol |
| Exact Mass | 223.14 |
| IUPAC Name | 3-(1-cyclohexa-2,4-dien-1-ylsulfanylethyl)piperidine |
| SMILES | CC(SC1C=CC=CC1)C1CCCNC1 |
| InChI | InChI=1S/C13H21NS/c1-11(12-6-5-9-14-10-12)15-13-7-3-2-4-8-13/h2-4,7,11-14H,5-6,8-10H2,1H3 |
| InChIKey | NOPOXZBNAHMMIA-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.39 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |