C12H21NS — CID 123393048
4-(7-methyl-2,3,4,5-tetrahydrothiepin-2-yl)piperidine (PubChem CID 123393048) has the molecular formula C12H21NS and a molecular weight of 211.37 g/mol. Its IUPAC name is 4-(7-methyl-2,3,4,5-tetrahydrothiepin-2-yl)piperidine.
| Compound Name | 4-(7-methyl-2,3,4,5-tetrahydrothiepin-2-yl)piperidine |
|---|---|
| PubChem CID | 123393048 |
| Molecular Formula | C12H21NS |
| Molecular Weight | 211.37 g/mol |
| Exact Mass | 211.14 |
| IUPAC Name | 4-(7-methyl-2,3,4,5-tetrahydrothiepin-2-yl)piperidine |
| SMILES | CC1=CCCCC(C2CCNCC2)S1 |
| InChI | InChI=1S/C12H21NS/c1-10-4-2-3-5-12(14-10)11-6-8-13-9-7-11/h4,11-13H,2-3,5-9H2,1H3 |
| InChIKey | QVXNPJCXWCUSMR-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.37 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |