C15H27NS — CID 143716587
5,9-dipropyl-2,3,4,5,6,7,8,9-octahydrocyclohepta[b][1,4]thiazine (PubChem CID 143716587) has the molecular formula C15H27NS and a molecular weight of 253.45 g/mol. Its IUPAC name is 5,9-dipropyl-2,3,4,5,6,7,8,9-octahydrocyclohepta[b][1,4]thiazine.
| Compound Name | 5,9-dipropyl-2,3,4,5,6,7,8,9-octahydrocyclohepta[b][1,4]thiazine |
|---|---|
| PubChem CID | 143716587 |
| Molecular Formula | C15H27NS |
| Molecular Weight | 253.45 g/mol |
| Exact Mass | 253.19 |
| IUPAC Name | 5,9-dipropyl-2,3,4,5,6,7,8,9-octahydrocyclohepta[b][1,4]thiazine |
| SMILES | CCCC1CCCC(CCC)C2=C1NCCS2 |
| InChI | InChI=1S/C15H27NS/c1-3-6-12-8-5-9-13(7-4-2)15-14(12)16-10-11-17-15/h12-13,16H,3-11H2,1-2H3 |
| InChIKey | IBSQSHHHMIMCFK-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.45 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |