C16H29NS — CID 143716398
5-ethyl-11-propyl-2,3,4,5,6,7,8,9,10,11-decahydrocyclonona[b][1,4]thiazine (PubChem CID 143716398) has the molecular formula C16H29NS and a molecular weight of 267.48 g/mol. Its IUPAC name is 5-ethyl-11-propyl-2,3,4,5,6,7,8,9,10,11-decahydrocyclonona[b][1,4]thiazine.
| Compound Name | 5-ethyl-11-propyl-2,3,4,5,6,7,8,9,10,11-decahydrocyclonona[b][1,4]thiazine |
|---|---|
| PubChem CID | 143716398 |
| Molecular Formula | C16H29NS |
| Molecular Weight | 267.48 g/mol |
| Exact Mass | 267.20 |
| IUPAC Name | 5-ethyl-11-propyl-2,3,4,5,6,7,8,9,10,11-decahydrocyclonona[b][1,4]thiazine |
| SMILES | CCCC1CCCCCC(CC)C2=C1SCCN2 |
| InChI | InChI=1S/C16H29NS/c1-3-8-14-10-7-5-6-9-13(4-2)15-16(14)18-12-11-17-15/h13-14,17H,3-12H2,1-2H3 |
| InChIKey | OHQPZOTWNTYGRM-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.48 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |