C16H31NS — CID 143716348
5-methyl-6-undecan-4-yl-3,4-dihydro-2H-1,4-thiazine (PubChem CID 143716348) has the molecular formula C16H31NS and a molecular weight of 269.50 g/mol. Its IUPAC name is 5-methyl-6-undecan-4-yl-3,4-dihydro-2H-1,4-thiazine.
| Compound Name | 5-methyl-6-undecan-4-yl-3,4-dihydro-2H-1,4-thiazine |
|---|---|
| PubChem CID | 143716348 |
| Molecular Formula | C16H31NS |
| Molecular Weight | 269.50 g/mol |
| Exact Mass | 269.22 |
| IUPAC Name | 5-methyl-6-undecan-4-yl-3,4-dihydro-2H-1,4-thiazine |
| SMILES | CCCCCCCC(CCC)C1=C(C)NCCS1 |
| InChI | InChI=1S/C16H31NS/c1-4-6-7-8-9-11-15(10-5-2)16-14(3)17-12-13-18-16/h15,17H,4-13H2,1-3H3 |
| InChIKey | YPEMJVNRYWGXBO-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.50 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|