C10H17NS — CID 12998652
3,4,5,6,7,8,9,10-octahydro-2H-cycloocta[b][1,4]thiazine (PubChem CID 12998652) has the molecular formula C10H17NS and a molecular weight of 183.32 g/mol. Its IUPAC name is 3,4,5,6,7,8,9,10-octahydro-2H-cycloocta[b][1,4]thiazine.
| Compound Name | 3,4,5,6,7,8,9,10-octahydro-2H-cycloocta[b][1,4]thiazine |
|---|---|
| PubChem CID | 12998652 |
| Molecular Formula | C10H17NS |
| Molecular Weight | 183.32 g/mol |
| Exact Mass | 183.11 |
| IUPAC Name | 3,4,5,6,7,8,9,10-octahydro-2H-cycloocta[b][1,4]thiazine |
| SMILES | C1CCCC2=C(CC1)NCCS2 |
| InChI | InChI=1S/C10H17NS/c1-2-4-6-10-9(5-3-1)11-7-8-12-10/h11H,1-8H2 |
| InChIKey | XXZMGKVDWQJYCC-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.32 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |