C14H31NS — CID 145443768
2,5-dimethyl-4-pentyl-2,3-dihydro-1,3-thiazole;ethane (PubChem CID 145443768) has the molecular formula C14H31NS and a molecular weight of 245.48 g/mol. Its IUPAC name is 2,5-dimethyl-4-pentyl-2,3-dihydro-1,3-thiazole;ethane.
| Compound Name | 2,5-dimethyl-4-pentyl-2,3-dihydro-1,3-thiazole;ethane |
|---|---|
| PubChem CID | 145443768 |
| Molecular Formula | C14H31NS |
| Molecular Weight | 245.48 g/mol |
| Exact Mass | 245.22 |
| IUPAC Name | 2,5-dimethyl-4-pentyl-2,3-dihydro-1,3-thiazole;ethane |
| SMILES | CC.CC.CCCCCC1=C(C)SC(C)N1 |
| InChI | InChI=1S/C10H19NS.2C2H6/c1-4-5-6-7-10-8(2)12-9(3)11-10;2*1-2/h9,11H,4-7H2,1-3H3;2*1-2H3 |
| InChIKey | JJFDZZWESJMASZ-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.48 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|