C10H21N3S — CID 143653342
(4S)-2-(aminomethylsulfanyl)-4-N-propylcyclohexene-1,4-diamine (PubChem CID 143653342) has the molecular formula C10H21N3S and a molecular weight of 215.37 g/mol. Its IUPAC name is (4S)-2-(aminomethylsulfanyl)-4-N-propylcyclohexene-1,4-diamine.
| Compound Name | (4S)-2-(aminomethylsulfanyl)-4-N-propylcyclohexene-1,4-diamine |
|---|---|
| PubChem CID | 143653342 |
| Molecular Formula | C10H21N3S |
| Molecular Weight | 215.37 g/mol |
| Exact Mass | 215.15 |
| IUPAC Name | (4S)-2-(aminomethylsulfanyl)-4-N-propylcyclohexene-1,4-diamine |
| SMILES | CCCN[C@H]1CCC(N)=C(SCN)C1 |
| InChI | InChI=1S/C10H21N3S/c1-2-5-13-8-3-4-9(12)10(6-8)14-7-11/h8,13H,2-7,11-12H2,1H3/t8-/m0/s1 |
| InChIKey | OTACJDUVZBVWKM-QMMMGPOBSA-N |
| XLogP | 1.36 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.37 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|