C8H17N3S — CID 143653340
2-(aminomethylsulfanyl)-1-N-methylcyclohexene-1,4-diamine (PubChem CID 143653340) has the molecular formula C8H17N3S and a molecular weight of 187.31 g/mol. Its IUPAC name is 2-(aminomethylsulfanyl)-1-N-methylcyclohexene-1,4-diamine.
| Compound Name | 2-(aminomethylsulfanyl)-1-N-methylcyclohexene-1,4-diamine |
|---|---|
| PubChem CID | 143653340 |
| Molecular Formula | C8H17N3S |
| Molecular Weight | 187.31 g/mol |
| Exact Mass | 187.11 |
| IUPAC Name | 2-(aminomethylsulfanyl)-1-N-methylcyclohexene-1,4-diamine |
| SMILES | CNC1=C(SCN)CC(N)CC1 |
| InChI | InChI=1S/C8H17N3S/c1-11-7-3-2-6(10)4-8(7)12-5-9/h6,11H,2-5,9-10H2,1H3 |
| InChIKey | IYUAKMMCNAJYNA-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.31 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|