C11H23N3S — CID 143653343
(4S)-2-(aminomethylsulfanyl)-1-N-methyl-4-N-propylcyclohexene-1,4-diamine (PubChem CID 143653343) has the molecular formula C11H23N3S and a molecular weight of 229.39 g/mol. Its IUPAC name is (4S)-2-(aminomethylsulfanyl)-1-N-methyl-4-N-propylcyclohexene-1,4-diamine.
| Compound Name | (4S)-2-(aminomethylsulfanyl)-1-N-methyl-4-N-propylcyclohexene-1,4-diamine |
|---|---|
| PubChem CID | 143653343 |
| Molecular Formula | C11H23N3S |
| Molecular Weight | 229.39 g/mol |
| Exact Mass | 229.16 |
| IUPAC Name | (4S)-2-(aminomethylsulfanyl)-1-N-methyl-4-N-propylcyclohexene-1,4-diamine |
| SMILES | CCCN[C@H]1CCC(NC)=C(SCN)C1 |
| InChI | InChI=1S/C11H23N3S/c1-3-6-14-9-4-5-10(13-2)11(7-9)15-8-12/h9,13-14H,3-8,12H2,1-2H3/t9-/m0/s1 |
| InChIKey | JMDMDWNUGTYGLO-VIFPVBQESA-N |
| XLogP | 1.62 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.39 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|