C10H19NS — CID 142366117
ethane;2-methyl-2,3,4,5,6,7-hexahydro-1,3-benzothiazole (PubChem CID 142366117) has the molecular formula C10H19NS and a molecular weight of 185.34 g/mol. Its IUPAC name is ethane;2-methyl-2,3,4,5,6,7-hexahydro-1,3-benzothiazole.
| Compound Name | ethane;2-methyl-2,3,4,5,6,7-hexahydro-1,3-benzothiazole |
|---|---|
| PubChem CID | 142366117 |
| Molecular Formula | C10H19NS |
| Molecular Weight | 185.34 g/mol |
| Exact Mass | 185.12 |
| IUPAC Name | ethane;2-methyl-2,3,4,5,6,7-hexahydro-1,3-benzothiazole |
| SMILES | CC.CC1NC2=C(CCCC2)S1 |
| InChI | InChI=1S/C8H13NS.C2H6/c1-6-9-7-4-2-3-5-8(7)10-6;1-2/h6,9H,2-5H2,1H3;1-2H3 |
| InChIKey | XVSKWRVAHBJETQ-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.34 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |