C9H16N2S — CID 129016134
(2-methyl-2,3,4,5,6,7-hexahydro-1,3-benzothiazol-7-yl)methanamine (PubChem CID 129016134) has the molecular formula C9H16N2S and a molecular weight of 184.31 g/mol. Its IUPAC name is (2-methyl-2,3,4,5,6,7-hexahydro-1,3-benzothiazol-7-yl)methanamine.
| Compound Name | (2-methyl-2,3,4,5,6,7-hexahydro-1,3-benzothiazol-7-yl)methanamine |
|---|---|
| PubChem CID | 129016134 |
| Molecular Formula | C9H16N2S |
| Molecular Weight | 184.31 g/mol |
| Exact Mass | 184.10 |
| IUPAC Name | (2-methyl-2,3,4,5,6,7-hexahydro-1,3-benzothiazol-7-yl)methanamine |
| SMILES | CC1NC2=C(S1)C(CN)CCC2 |
| InChI | InChI=1S/C9H16N2S/c1-6-11-8-4-2-3-7(5-10)9(8)12-6/h6-7,11H,2-5,10H2,1H3 |
| InChIKey | ZNDFITKYORQKOT-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.31 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |