C9H15NS — CID 143716564
5,7-dimethyl-2,3,4,5,6,7-hexahydrocyclopenta[b][1,4]thiazine (PubChem CID 143716564) has the molecular formula C9H15NS and a molecular weight of 169.29 g/mol. Its IUPAC name is 5,7-dimethyl-2,3,4,5,6,7-hexahydrocyclopenta[b][1,4]thiazine.
| Compound Name | 5,7-dimethyl-2,3,4,5,6,7-hexahydrocyclopenta[b][1,4]thiazine |
|---|---|
| PubChem CID | 143716564 |
| Molecular Formula | C9H15NS |
| Molecular Weight | 169.29 g/mol |
| Exact Mass | 169.09 |
| IUPAC Name | 5,7-dimethyl-2,3,4,5,6,7-hexahydrocyclopenta[b][1,4]thiazine |
| SMILES | CC1CC(C)C2=C1NCCS2 |
| InChI | InChI=1S/C9H15NS/c1-6-5-7(2)9-8(6)10-3-4-11-9/h6-7,10H,3-5H2,1-2H3 |
| InChIKey | HBEWFEBUNKLJIR-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.29 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |