C14H25NS2 — CID 147465421
5-methyl-11-propyl-2,3,5,6,8,9,10,11-octahydro-1H-thionino[4,5-b][1,4]thiazine (PubChem CID 147465421) has the molecular formula C14H25NS2 and a molecular weight of 271.49 g/mol. Its IUPAC name is 5-methyl-11-propyl-2,3,5,6,8,9,10,11-octahydro-1H-thionino[4,5-b][1,4]thiazine.
| Compound Name | 5-methyl-11-propyl-2,3,5,6,8,9,10,11-octahydro-1H-thionino[4,5-b][1,4]thiazine |
|---|---|
| PubChem CID | 147465421 |
| Molecular Formula | C14H25NS2 |
| Molecular Weight | 271.49 g/mol |
| Exact Mass | 271.14 |
| IUPAC Name | 5-methyl-11-propyl-2,3,5,6,8,9,10,11-octahydro-1H-thionino[4,5-b][1,4]thiazine |
| SMILES | CCCC1CCCSCC(C)C2=C1NCCS2 |
| InChI | InChI=1S/C14H25NS2/c1-3-5-12-6-4-8-16-10-11(2)14-13(12)15-7-9-17-14/h11-12,15H,3-10H2,1-2H3 |
| InChIKey | FASPAAJJZUCNQF-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.49 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |