C7H13NS — CID 143642404
4-ethyl-2,5-dimethyl-2,3-dihydro-1,3-thiazole (PubChem CID 143642404) has the molecular formula C7H13NS and a molecular weight of 143.25 g/mol. Its IUPAC name is 4-ethyl-2,5-dimethyl-2,3-dihydro-1,3-thiazole.
| Compound Name | 4-ethyl-2,5-dimethyl-2,3-dihydro-1,3-thiazole |
|---|---|
| PubChem CID | 143642404 |
| Molecular Formula | C7H13NS |
| Molecular Weight | 143.25 g/mol |
| Exact Mass | 143.08 |
| IUPAC Name | 4-ethyl-2,5-dimethyl-2,3-dihydro-1,3-thiazole |
| SMILES | CCC1=C(C)SC(C)N1 |
| InChI | InChI=1S/C7H13NS/c1-4-7-5(2)9-6(3)8-7/h6,8H,4H2,1-3H3 |
| InChIKey | UKDBJQWXVIKVIS-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 143.25 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |