About 2,4-dimethyl-5-propan-2-yl-2,3-dihydro-1,3-thiazole
2,4-dimethyl-5-propan-2-yl-2,3-dihydro-1,3-thiazole (PubChem CID 58359101) has the molecular formula C8H15NS
and a molecular weight of 157.28 g/mol. Its IUPAC name is 2,4-dimethyl-5-propan-2-yl-2,3-dihydro-1,3-thiazole.
Analyze 2,4-dimethyl-5-propan-2-yl-2,3-dihydro-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dimethyl-5-propan-2-yl-2,3-dihydro-1,3-thiazole?
The IUPAC name of 2,4-dimethyl-5-propan-2-yl-2,3-dihydro-1,3-thiazole (CID 58359101) is 2,4-dimethyl-5-propan-2-yl-2,3-dihydro-1,3-thiazole.
What is the SMILES notation for 2,4-dimethyl-5-propan-2-yl-2,3-dihydro-1,3-thiazole?
The canonical SMILES for 2,4-dimethyl-5-propan-2-yl-2,3-dihydro-1,3-thiazole is CC1=C(C(C)C)SC(C)N1.
What is the InChIKey of 2,4-dimethyl-5-propan-2-yl-2,3-dihydro-1,3-thiazole?
The InChIKey is NKJURVFOJMZDMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15NS/c1-5(2)8-6(3)9-7(4)10-8/h5,7,9H,1-4H3.
What are the key properties of 2,4-dimethyl-5-propan-2-yl-2,3-dihydro-1,3-thiazole?
2,4-dimethyl-5-propan-2-yl-2,3-dihydro-1,3-thiazole has a molecular weight of 157.28 g/mol, XLogP of 2.56, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dimethyl-5-propan-2-yl-2,3-dihydro-1,3-thiazole is sourced from PubChem (CID 58359101), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).