About 4,5-dimethyl-2-propan-2-yl-2,3-dihydro-1,3-thiazole
4,5-dimethyl-2-propan-2-yl-2,3-dihydro-1,3-thiazole (PubChem CID 23384098) has the molecular formula C8H15NS
and a molecular weight of 157.28 g/mol. Its IUPAC name is 4,5-dimethyl-2-propan-2-yl-2,3-dihydro-1,3-thiazole.
Analyze 4,5-dimethyl-2-propan-2-yl-2,3-dihydro-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-dimethyl-2-propan-2-yl-2,3-dihydro-1,3-thiazole?
The IUPAC name of 4,5-dimethyl-2-propan-2-yl-2,3-dihydro-1,3-thiazole (CID 23384098) is 4,5-dimethyl-2-propan-2-yl-2,3-dihydro-1,3-thiazole.
What is the SMILES notation for 4,5-dimethyl-2-propan-2-yl-2,3-dihydro-1,3-thiazole?
The canonical SMILES for 4,5-dimethyl-2-propan-2-yl-2,3-dihydro-1,3-thiazole is CC1=C(C)SC(C(C)C)N1.
What is the InChIKey of 4,5-dimethyl-2-propan-2-yl-2,3-dihydro-1,3-thiazole?
The InChIKey is LBNSMEOONYUWER-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15NS/c1-5(2)8-9-6(3)7(4)10-8/h5,8-9H,1-4H3.
What are the key properties of 4,5-dimethyl-2-propan-2-yl-2,3-dihydro-1,3-thiazole?
4,5-dimethyl-2-propan-2-yl-2,3-dihydro-1,3-thiazole has a molecular weight of 157.28 g/mol, XLogP of 2.56, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-dimethyl-2-propan-2-yl-2,3-dihydro-1,3-thiazole is sourced from PubChem (CID 23384098), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).