About (4-methyl-2-propan-2-yl-3,6-dihydro-2H-1,3-thiazin-5-yl)methanethiol
(4-methyl-2-propan-2-yl-3,6-dihydro-2H-1,3-thiazin-5-yl)methanethiol (PubChem CID 155748976) has the molecular formula C9H17NS2
and a molecular weight of 203.38 g/mol. Its IUPAC name is (4-methyl-2-propan-2-yl-3,6-dihydro-2H-1,3-thiazin-5-yl)methanethiol.
Molecular Properties
| Compound Name | (4-methyl-2-propan-2-yl-3,6-dihydro-2H-1,3-thiazin-5-yl)methanethiol |
| PubChem CID | 155748976 |
| Molecular Formula | C9H17NS2 |
| Molecular Weight | 203.38 g/mol |
| Exact Mass | 203.08 |
| IUPAC Name | (4-methyl-2-propan-2-yl-3,6-dihydro-2H-1,3-thiazin-5-yl)methanethiol |
| SMILES | CC1=C(CS)CSC(C(C)C)N1 |
| InChI | InChI=1S/C9H17NS2/c1-6(2)9-10-7(3)8(4-11)5-12-9/h6,9-11H,4-5H2,1-3H3 |
| InChIKey | ACIVWEOMGCUSKD-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.38 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze (4-methyl-2-propan-2-yl-3,6-dihydro-2H-1,3-thiazin-5-yl)methanethiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-methyl-2-propan-2-yl-3,6-dihydro-2H-1,3-thiazin-5-yl)methanethiol?
The IUPAC name of (4-methyl-2-propan-2-yl-3,6-dihydro-2H-1,3-thiazin-5-yl)methanethiol (CID 155748976) is (4-methyl-2-propan-2-yl-3,6-dihydro-2H-1,3-thiazin-5-yl)methanethiol.
What is the SMILES notation for (4-methyl-2-propan-2-yl-3,6-dihydro-2H-1,3-thiazin-5-yl)methanethiol?
The canonical SMILES for (4-methyl-2-propan-2-yl-3,6-dihydro-2H-1,3-thiazin-5-yl)methanethiol is CC1=C(CS)CSC(C(C)C)N1.
What is the InChIKey of (4-methyl-2-propan-2-yl-3,6-dihydro-2H-1,3-thiazin-5-yl)methanethiol?
The InChIKey is ACIVWEOMGCUSKD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17NS2/c1-6(2)9-10-7(3)8(4-11)5-12-9/h6,9-11H,4-5H2,1-3H3.
What are the key properties of (4-methyl-2-propan-2-yl-3,6-dihydro-2H-1,3-thiazin-5-yl)methanethiol?
(4-methyl-2-propan-2-yl-3,6-dihydro-2H-1,3-thiazin-5-yl)methanethiol has a molecular weight of 203.38 g/mol, XLogP of 2.51, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-methyl-2-propan-2-yl-3,6-dihydro-2H-1,3-thiazin-5-yl)methanethiol is sourced from PubChem (CID 155748976), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).